C13H17F3N4O2 — CID 94658153
trans-(1S,2S)-N'-(4-methoxypyrimidin-2-yl)-2-(trifluoromethyl)cyclohexane-1-carbohydrazide (PubChem CID 94658153) has the molecular formula C13H17F3N4O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is trans-(1S,2S)-N'-(4-methoxypyrimidin-2-yl)-2-(trifluoromethyl)cyclohexane-1-carbohydrazide.
| Compound Name | trans-(1S,2S)-N'-(4-methoxypyrimidin-2-yl)-2-(trifluoromethyl)cyclohexane-1-carbohydrazide |
|---|---|
| PubChem CID | 94658153 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | trans-(1S,2S)-N'-(4-methoxypyrimidin-2-yl)-2-(trifluoromethyl)cyclohexane-1-carbohydrazide |
| SMILES | COc1ccnc(NNC(=O)[C@H]2CCCC[C@@H]2C(F)(F)F)n1 |
| InChI | InChI=1S/C13H17F3N4O2/c1-22-10-6-7-17-12(18-10)20-19-11(21)8-4-2-3-5-9(8)13(14,15)16/h6-9H,2-5H2,1H3,(H,19,21)(H,17,18,20)/t8-,9-/m0/s1 |
| InChIKey | VEGKUPFVHQJPBM-IUCAKERBSA-N |
| XLogP | 2.30 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|