C17H24N4O4 — CID 56800020
1-(2-methoxyethyl)-5-[3-(2-oxoimidazolidin-1-yl)piperidine-1-carbonyl]pyridin-2-one (PubChem CID 56800020) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-[3-(2-oxoimidazolidin-1-yl)piperidine-1-carbonyl]pyridin-2-one.
| Compound Name | 1-(2-methoxyethyl)-5-[3-(2-oxoimidazolidin-1-yl)piperidine-1-carbonyl]pyridin-2-one |
|---|---|
| PubChem CID | 56800020 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-(2-methoxyethyl)-5-[3-(2-oxoimidazolidin-1-yl)piperidine-1-carbonyl]pyridin-2-one |
| SMILES | COCCn1cc(C(=O)N2CCCC(N3CCNC3=O)C2)ccc1=O |
| InChI | InChI=1S/C17H24N4O4/c1-25-10-9-19-11-13(4-5-15(19)22)16(23)20-7-2-3-14(12-20)21-8-6-18-17(21)24/h4-5,11,14H,2-3,6-10,12H2,1H3,(H,18,24) |
| InChIKey | PJLBSWCQDUYEHA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |