C13H12N8O2 — CID 56800574
N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 56800574) has the molecular formula C13H12N8O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 56800574 |
| Molecular Formula | C13H12N8O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | O=C(CNC(=O)c1cccc(-n2cnnn2)c1)Nc1cn[nH]c1 |
| InChI | InChI=1S/C13H12N8O2/c22-12(18-10-5-15-16-6-10)7-14-13(23)9-2-1-3-11(4-9)21-8-17-19-20-21/h1-6,8H,7H2,(H,14,23)(H,15,16)(H,18,22) |
| InChIKey | CMFKOKULFXUYOS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |