C14H24N2O5S — CID 56800960
tert-butyl (4S)-4-(oxan-2-yloxycarbamoyl)-1,3-thiazolidine-3-carboxylate (PubChem CID 56800960) has the molecular formula C14H24N2O5S and a molecular weight of 332.42 g/mol. Its IUPAC name is tert-butyl (4S)-4-(oxan-2-yloxycarbamoyl)-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-(oxan-2-yloxycarbamoyl)-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 56800960 |
| Molecular Formula | C14H24N2O5S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | tert-butyl (4S)-4-(oxan-2-yloxycarbamoyl)-1,3-thiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CSC[C@@H]1C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C14H24N2O5S/c1-14(2,3)20-13(18)16-9-22-8-10(16)12(17)15-21-11-6-4-5-7-19-11/h10-11H,4-9H2,1-3H3,(H,15,17)/t10-,11?/m1/s1 |
| InChIKey | SMUCZLBQFYEHEU-NFJWQWPMSA-N |
| XLogP | 1.87 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|