C18H27N3O2S — CID 56801108
3-methoxy-N-(3-methyl-4-thiomorpholin-4-ylphenyl)piperidine-1-carboxamide (PubChem CID 56801108) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is 3-methoxy-N-(3-methyl-4-thiomorpholin-4-ylphenyl)piperidine-1-carboxamide.
| Compound Name | 3-methoxy-N-(3-methyl-4-thiomorpholin-4-ylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 56801108 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-methoxy-N-(3-methyl-4-thiomorpholin-4-ylphenyl)piperidine-1-carboxamide |
| SMILES | COC1CCCN(C(=O)Nc2ccc(N3CCSCC3)c(C)c2)C1 |
| InChI | InChI=1S/C18H27N3O2S/c1-14-12-15(5-6-17(14)20-8-10-24-11-9-20)19-18(22)21-7-3-4-16(13-21)23-2/h5-6,12,16H,3-4,7-11,13H2,1-2H3,(H,19,22) |
| InChIKey | MKIATFJZYCPGPX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|