C20H23N3O2S2 — CID 86876202
5-(cyclopropanecarbonylamino)-N-(3-methyl-4-thiomorpholin-4-ylphenyl)thiophene-2-carboxamide (PubChem CID 86876202) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 5-(cyclopropanecarbonylamino)-N-(3-methyl-4-thiomorpholin-4-ylphenyl)thiophene-2-carboxamide.
| Compound Name | 5-(cyclopropanecarbonylamino)-N-(3-methyl-4-thiomorpholin-4-ylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 86876202 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 5-(cyclopropanecarbonylamino)-N-(3-methyl-4-thiomorpholin-4-ylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(NC(=O)C3CC3)s2)ccc1N1CCSCC1 |
| InChI | InChI=1S/C20H23N3O2S2/c1-13-12-15(4-5-16(13)23-8-10-26-11-9-23)21-20(25)17-6-7-18(27-17)22-19(24)14-2-3-14/h4-7,12,14H,2-3,8-11H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | GRMNLMJWBUCVQS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|