C18H15N5O5S — CID 56804366
N-(1,3-benzodioxol-5-ylmethyl)-2-(5,5-dioxo-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazin-1-yl)acetamide (PubChem CID 56804366) has the molecular formula C18H15N5O5S and a molecular weight of 413.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(5,5-dioxo-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazin-1-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(5,5-dioxo-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazin-1-yl)acetamide |
|---|---|
| PubChem CID | 56804366 |
| Molecular Formula | C18H15N5O5S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(5,5-dioxo-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazin-1-yl)acetamide |
| SMILES | O=C(CN1C=NC2=NS(=O)(=O)c3ccccc3N21)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15N5O5S/c24-17(19-8-12-5-6-14-15(7-12)28-11-27-14)9-22-10-20-18-21-29(25,26)16-4-2-1-3-13(16)23(18)22/h1-7,10H,8-9,11H2,(H,19,24) |
| InChIKey | YVJZKVJRRVXCFT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |