C15H32N4O2S — CID 56806853
N-[1-cyclopropylethyl(methyl)sulfamoyl]-N-methyl-3-(4-methylpiperazin-1-yl)propan-1-amine (PubChem CID 56806853) has the molecular formula C15H32N4O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is N-[1-cyclopropylethyl(methyl)sulfamoyl]-N-methyl-3-(4-methylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[1-cyclopropylethyl(methyl)sulfamoyl]-N-methyl-3-(4-methylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 56806853 |
| Molecular Formula | C15H32N4O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N-[1-cyclopropylethyl(methyl)sulfamoyl]-N-methyl-3-(4-methylpiperazin-1-yl)propan-1-amine |
| SMILES | CC(C1CC1)N(C)S(=O)(=O)N(C)CCCN1CCN(C)CC1 |
| InChI | InChI=1S/C15H32N4O2S/c1-14(15-6-7-15)18(4)22(20,21)17(3)8-5-9-19-12-10-16(2)11-13-19/h14-15H,5-13H2,1-4H3 |
| InChIKey | ULODHGPHKJPALD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |