About 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide
1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide (PubChem CID 56807296) has the molecular formula C17H23N5O2
and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide |
| PubChem CID | 56807296 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)NCCCc2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C17H23N5O2/c18-16(23)12-7-10-22(11-8-12)17(24)19-9-3-6-15-20-13-4-1-2-5-14(13)21-15/h1-2,4-5,12H,3,6-11H2,(H2,18,23)(H,19,24)(H,20,21) |
| InChIKey | YGJIXBARKVXHSN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide?
The IUPAC name of 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide (CID 56807296) is 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide.
What is the SMILES notation for 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide?
The canonical SMILES for 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide is NC(=O)C1CCN(C(=O)NCCCc2nc3ccccc3[nH]2)CC1.
What is the InChIKey of 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide?
The InChIKey is YGJIXBARKVXHSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5O2/c18-16(23)12-7-10-22(11-8-12)17(24)19-9-3-6-15-20-13-4-1-2-5-14(13)21-15/h1-2,4-5,12H,3,6-11H2,(H2,18,23)(H,19,24)(H,20,21).
What are the key properties of 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide?
1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide has a molecular weight of 329.40 g/mol, XLogP of 1.40, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide is sourced from PubChem (CID 56807296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).