C17H23N5O2 — CID 56807296
1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide (PubChem CID 56807296) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 56807296 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-N-[3-(1H-benzimidazol-2-yl)propyl]piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)NCCCc2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C17H23N5O2/c18-16(23)12-7-10-22(11-8-12)17(24)19-9-3-6-15-20-13-4-1-2-5-14(13)21-15/h1-2,4-5,12H,3,6-11H2,(H2,18,23)(H,19,24)(H,20,21) |
| InChIKey | YGJIXBARKVXHSN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|