C17H24N4OS — CID 95771576
(2R,3R)-N-[3-(1H-benzimidazol-2-yl)propyl]-2,3-dimethylthiomorpholine-4-carboxamide (PubChem CID 95771576) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is (2R,3R)-N-[3-(1H-benzimidazol-2-yl)propyl]-2,3-dimethylthiomorpholine-4-carboxamide.
| Compound Name | (2R,3R)-N-[3-(1H-benzimidazol-2-yl)propyl]-2,3-dimethylthiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 95771576 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (2R,3R)-N-[3-(1H-benzimidazol-2-yl)propyl]-2,3-dimethylthiomorpholine-4-carboxamide |
| SMILES | C[C@@H]1[C@@H](C)SCCN1C(=O)NCCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H24N4OS/c1-12-13(2)23-11-10-21(12)17(22)18-9-5-8-16-19-14-6-3-4-7-15(14)20-16/h3-4,6-7,12-13H,5,8-11H2,1-2H3,(H,18,22)(H,19,20)/t12-,13-/m1/s1 |
| InChIKey | VMCREPQMSKUDSZ-CHWSQXEVSA-N |
| XLogP | 3.03 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|