C15H23N5O3 — CID 56809245
2-[4-[(2-ethoxy-3-pyridinyl)carbamoylamino]piperidin-1-yl]acetamide (PubChem CID 56809245) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[4-[(2-ethoxy-3-pyridinyl)carbamoylamino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[(2-ethoxy-3-pyridinyl)carbamoylamino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 56809245 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-[4-[(2-ethoxy-3-pyridinyl)carbamoylamino]piperidin-1-yl]acetamide |
| SMILES | CCOc1ncccc1NC(=O)NC1CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C15H23N5O3/c1-2-23-14-12(4-3-7-17-14)19-15(22)18-11-5-8-20(9-6-11)10-13(16)21/h3-4,7,11H,2,5-6,8-10H2,1H3,(H2,16,21)(H2,18,19,22) |
| InChIKey | DSQIIRWNSHDAMP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |