C15H19N3OS — CID 56813292
2-[(2-anilino-1,3-thiazol-4-yl)methyl-cyclopropylamino]ethanol (PubChem CID 56813292) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[(2-anilino-1,3-thiazol-4-yl)methyl-cyclopropylamino]ethanol.
| Compound Name | 2-[(2-anilino-1,3-thiazol-4-yl)methyl-cyclopropylamino]ethanol |
|---|---|
| PubChem CID | 56813292 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[(2-anilino-1,3-thiazol-4-yl)methyl-cyclopropylamino]ethanol |
| SMILES | OCCN(Cc1csc(Nc2ccccc2)n1)C1CC1 |
| InChI | InChI=1S/C15H19N3OS/c19-9-8-18(14-6-7-14)10-13-11-20-15(17-13)16-12-4-2-1-3-5-12/h1-5,11,14,19H,6-10H2,(H,16,17) |
| InChIKey | XHTIYZHEACLGTN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |