C20H25N3 — CID 56823418
N-[(E)-3-phenylprop-2-enyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine (PubChem CID 56823418) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[(E)-3-phenylprop-2-enyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine.
| Compound Name | N-[(E)-3-phenylprop-2-enyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 56823418 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-[(E)-3-phenylprop-2-enyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine |
| SMILES | C(=C/c1ccccc1)\CNC1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C20H25N3/c1-2-7-18(8-3-1)9-6-14-21-19-11-15-23(16-12-19)17-20-10-4-5-13-22-20/h1-10,13,19,21H,11-12,14-17H2/b9-6+ |
| InChIKey | YMSQATWYSPCCAV-RMKNXTFCSA-N |
| XLogP | 3.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |