C20H26FN3O — CID 97108511
(2R)-2-(4-fluorophenyl)-1-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]propan-2-ol (PubChem CID 97108511) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-1-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]propan-2-ol.
| Compound Name | (2R)-2-(4-fluorophenyl)-1-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 97108511 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-1-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]propan-2-ol |
| SMILES | C[C@](O)(CNC1CCN(Cc2ccccn2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H26FN3O/c1-20(25,16-5-7-17(21)8-6-16)15-23-18-9-12-24(13-10-18)14-19-4-2-3-11-22-19/h2-8,11,18,23,25H,9-10,12-15H2,1H3/t20-/m0/s1 |
| InChIKey | NCYXVGBDYRZVDG-FQEVSTJZSA-N |
| XLogP | 2.68 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |