C16H25FN4 — CID 78085720
N-[(4-fluoropyrrolidin-2-yl)methyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine (PubChem CID 78085720) has the molecular formula C16H25FN4 and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[(4-fluoropyrrolidin-2-yl)methyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine.
| Compound Name | N-[(4-fluoropyrrolidin-2-yl)methyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 78085720 |
| Molecular Formula | C16H25FN4 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | N-[(4-fluoropyrrolidin-2-yl)methyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine |
| SMILES | FC1CNC(CNC2CCN(Cc3ccccn3)CC2)C1 |
| InChI | InChI=1S/C16H25FN4/c17-13-9-16(19-10-13)11-20-14-4-7-21(8-5-14)12-15-3-1-2-6-18-15/h1-3,6,13-14,16,19-20H,4-5,7-12H2 |
| InChIKey | XXOBMDFZWVNUFW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |