C13H16FNO2S — CID 56827603
N-(cyclopropylmethyl)-2-[(3-fluorophenyl)methylsulfinyl]acetamide (PubChem CID 56827603) has the molecular formula C13H16FNO2S and a molecular weight of 269.34 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[(3-fluorophenyl)methylsulfinyl]acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-[(3-fluorophenyl)methylsulfinyl]acetamide |
|---|---|
| PubChem CID | 56827603 |
| Molecular Formula | C13H16FNO2S |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[(3-fluorophenyl)methylsulfinyl]acetamide |
| SMILES | O=C(CS(=O)Cc1cccc(F)c1)NCC1CC1 |
| InChI | InChI=1S/C13H16FNO2S/c14-12-3-1-2-11(6-12)8-18(17)9-13(16)15-7-10-4-5-10/h1-3,6,10H,4-5,7-9H2,(H,15,16) |
| InChIKey | UIMBAZHANFJAGZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |