C20H25NO4 — CID 56834303
[(2S)-1-(3,4-dimethoxy-2-methyl-8a,9-dihydro-4bH-carbazol-1-yl)propan-2-yl] acetate (PubChem CID 56834303) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is [(2S)-1-(3,4-dimethoxy-2-methyl-8a,9-dihydro-4bH-carbazol-1-yl)propan-2-yl] acetate.
| Compound Name | [(2S)-1-(3,4-dimethoxy-2-methyl-8a,9-dihydro-4bH-carbazol-1-yl)propan-2-yl] acetate |
|---|---|
| PubChem CID | 56834303 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [(2S)-1-(3,4-dimethoxy-2-methyl-8a,9-dihydro-4bH-carbazol-1-yl)propan-2-yl] acetate |
| SMILES | COc1c(C)c(C[C@H](C)OC(C)=O)c2c(c1OC)C1C=CC=CC1N2 |
| InChI | InChI=1S/C20H25NO4/c1-11(25-13(3)22)10-15-12(2)19(23-4)20(24-5)17-14-8-6-7-9-16(14)21-18(15)17/h6-9,11,14,16,21H,10H2,1-5H3/t11-,14?,16?/m0/s1 |
| InChIKey | OEGNXNCJFTXEJH-WJFWJRBTSA-N |
| XLogP | 3.51 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|