C19H23NO5 — CID 11267969
[2-cyclohexa-2,5-dien-1-yl-6-methoxy-3-(methoxycarbonylamino)-4,5-dimethylphenyl] acetate (PubChem CID 11267969) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is [2-cyclohexa-2,5-dien-1-yl-6-methoxy-3-(methoxycarbonylamino)-4,5-dimethylphenyl] acetate.
| Compound Name | [2-cyclohexa-2,5-dien-1-yl-6-methoxy-3-(methoxycarbonylamino)-4,5-dimethylphenyl] acetate |
|---|---|
| PubChem CID | 11267969 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [2-cyclohexa-2,5-dien-1-yl-6-methoxy-3-(methoxycarbonylamino)-4,5-dimethylphenyl] acetate |
| SMILES | COC(=O)Nc1c(C)c(C)c(OC)c(OC(C)=O)c1C1C=CCC=C1 |
| InChI | InChI=1S/C19H23NO5/c1-11-12(2)17(23-4)18(25-13(3)21)15(14-9-7-6-8-10-14)16(11)20-19(22)24-5/h7-10,14H,6H2,1-5H3,(H,20,22) |
| InChIKey | FFAJTDPONOYFPE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|