C20H21FeNO6 — CID 135047931
[3-amino-2-[(1S)-cyclohexa-2,4-dien-1-yl]-6-methoxy-4,5-dimethylphenyl] acetate;carbon monoxide;iron (PubChem CID 135047931) has the molecular formula C20H21FeNO6 and a molecular weight of 427.23 g/mol. Its IUPAC name is [3-amino-2-[(1S)-cyclohexa-2,4-dien-1-yl]-6-methoxy-4,5-dimethylphenyl] acetate;carbon monoxide;iron.
| Compound Name | [3-amino-2-[(1S)-cyclohexa-2,4-dien-1-yl]-6-methoxy-4,5-dimethylphenyl] acetate;carbon monoxide;iron |
|---|---|
| PubChem CID | 135047931 |
| Molecular Formula | C20H21FeNO6 |
| Molecular Weight | 427.23 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | [3-amino-2-[(1S)-cyclohexa-2,4-dien-1-yl]-6-methoxy-4,5-dimethylphenyl] acetate;carbon monoxide;iron |
| SMILES | COc1c(C)c(C)c(N)c([C@@H]2C=CC=CC2)c1OC(C)=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C17H21NO3.3CO.Fe/c1-10-11(2)16(20-4)17(21-12(3)19)14(15(10)18)13-8-6-5-7-9-13;3*1-2;/h5-8,13H,9,18H2,1-4H3;;;;/t13-;;;;/m1..../s1 |
| InChIKey | GCDNOTKKBLTKFJ-SVZPRBGCSA-N |
| XLogP | 3.30 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|