C20H21FeNO7 — CID 135051424
[3-amino-2-[(1R)-cyclohexa-2,4-dien-1-yl]-4,6-dimethoxy-5-methylphenyl] acetate;carbon monoxide;iron (PubChem CID 135051424) has the molecular formula C20H21FeNO7 and a molecular weight of 443.23 g/mol. Its IUPAC name is [3-amino-2-[(1R)-cyclohexa-2,4-dien-1-yl]-4,6-dimethoxy-5-methylphenyl] acetate;carbon monoxide;iron.
| Compound Name | [3-amino-2-[(1R)-cyclohexa-2,4-dien-1-yl]-4,6-dimethoxy-5-methylphenyl] acetate;carbon monoxide;iron |
|---|---|
| PubChem CID | 135051424 |
| Molecular Formula | C20H21FeNO7 |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | [3-amino-2-[(1R)-cyclohexa-2,4-dien-1-yl]-4,6-dimethoxy-5-methylphenyl] acetate;carbon monoxide;iron |
| SMILES | COc1c(C)c(OC)c(OC(C)=O)c([C@H]2C=CC=CC2)c1N.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C17H21NO4.3CO.Fe/c1-10-15(20-3)14(18)13(12-8-6-5-7-9-12)17(16(10)21-4)22-11(2)19;3*1-2;/h5-8,12H,9,18H2,1-4H3;;;;/t12-;;;;/m0..../s1 |
| InChIKey | QDQLWRXEUHJLAB-KCOFNFEMSA-N |
| XLogP | 3.00 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|