C20H20FNO8 — CID 169091137
6-amino-5-fluoro-7-methoxy-8-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,4-benzodioxine-2,3-dione (PubChem CID 169091137) has the molecular formula C20H20FNO8 and a molecular weight of 421.38 g/mol. Its IUPAC name is 6-amino-5-fluoro-7-methoxy-8-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,4-benzodioxine-2,3-dione.
| Compound Name | 6-amino-5-fluoro-7-methoxy-8-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,4-benzodioxine-2,3-dione |
|---|---|
| PubChem CID | 169091137 |
| Molecular Formula | C20H20FNO8 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 6-amino-5-fluoro-7-methoxy-8-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,4-benzodioxine-2,3-dione |
| SMILES | COc1cc(CCc2c(OC)c(N)c(F)c3oc(=O)c(=O)oc23)cc(OC)c1OC |
| InChI | InChI=1S/C20H20FNO8/c1-25-11-7-9(8-12(26-2)17(11)28-4)5-6-10-15(27-3)14(22)13(21)18-16(10)29-19(23)20(24)30-18/h7-8H,5-6,22H2,1-4H3 |
| InChIKey | NTDVYVPRDRCKTO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|