C17H21NO4 — CID 11812288
(3-amino-2-cyclohexa-2,4-dien-1-yl-4,6-dimethoxy-5-methylphenyl) acetate (PubChem CID 11812288) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (3-amino-2-cyclohexa-2,4-dien-1-yl-4,6-dimethoxy-5-methylphenyl) acetate.
| Compound Name | (3-amino-2-cyclohexa-2,4-dien-1-yl-4,6-dimethoxy-5-methylphenyl) acetate |
|---|---|
| PubChem CID | 11812288 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (3-amino-2-cyclohexa-2,4-dien-1-yl-4,6-dimethoxy-5-methylphenyl) acetate |
| SMILES | COc1c(C)c(OC)c(OC(C)=O)c(C2C=CC=CC2)c1N |
| InChI | InChI=1S/C17H21NO4/c1-10-15(20-3)14(18)13(12-8-6-5-7-9-12)17(16(10)21-4)22-11(2)19/h5-8,12H,9,18H2,1-4H3 |
| InChIKey | BXKHMEJMMNTSNW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|