C21H23FeNO8 — CID 11826833
[5-amino-2,4-dimethoxy-6-(3-methoxycyclohexa-2,4-dien-1-yl)-3-methylphenyl] acetate;carbon monoxide;iron (PubChem CID 11826833) has the molecular formula C21H23FeNO8 and a molecular weight of 473.26 g/mol. Its IUPAC name is [5-amino-2,4-dimethoxy-6-(3-methoxycyclohexa-2,4-dien-1-yl)-3-methylphenyl] acetate;carbon monoxide;iron.
| Compound Name | [5-amino-2,4-dimethoxy-6-(3-methoxycyclohexa-2,4-dien-1-yl)-3-methylphenyl] acetate;carbon monoxide;iron |
|---|---|
| PubChem CID | 11826833 |
| Molecular Formula | C21H23FeNO8 |
| Molecular Weight | 473.26 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [5-amino-2,4-dimethoxy-6-(3-methoxycyclohexa-2,4-dien-1-yl)-3-methylphenyl] acetate;carbon monoxide;iron |
| SMILES | COC1=CC(c2c(N)c(OC)c(C)c(OC)c2OC(C)=O)CC=C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C18H23NO5.3CO.Fe/c1-10-16(22-4)15(19)14(12-7-6-8-13(9-12)21-3)18(17(10)23-5)24-11(2)20;3*1-2;/h6,8-9,12H,7,19H2,1-5H3;;;; |
| InChIKey | DDTKZQJQGAYMOD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 139.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|