C23H23NO8S — CID 141167772
phenyl N-(1,3,6,7-tetramethoxy-9H-xanthen-4-yl)sulfamate (PubChem CID 141167772) has the molecular formula C23H23NO8S and a molecular weight of 473.50 g/mol. Its IUPAC name is phenyl N-(1,3,6,7-tetramethoxy-9H-xanthen-4-yl)sulfamate.
| Compound Name | phenyl N-(1,3,6,7-tetramethoxy-9H-xanthen-4-yl)sulfamate |
|---|---|
| PubChem CID | 141167772 |
| Molecular Formula | C23H23NO8S |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | phenyl N-(1,3,6,7-tetramethoxy-9H-xanthen-4-yl)sulfamate |
| SMILES | COc1cc2c(cc1OC)Oc1c(c(OC)cc(OC)c1NS(=O)(=O)Oc1ccccc1)C2 |
| InChI | InChI=1S/C23H23NO8S/c1-27-18-13-21(30-4)22(24-33(25,26)32-15-8-6-5-7-9-15)23-16(18)10-14-11-19(28-2)20(29-3)12-17(14)31-23/h5-9,11-13,24H,10H2,1-4H3 |
| InChIKey | PVEZDSGCOJRQKJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |