C17H25NO3 — CID 142148722
2-ethenyl-3-methoxy-5,6,7,8-tetrahydronaphthalen-1-amine;ethyl acetate (PubChem CID 142148722) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-ethenyl-3-methoxy-5,6,7,8-tetrahydronaphthalen-1-amine;ethyl acetate.
| Compound Name | 2-ethenyl-3-methoxy-5,6,7,8-tetrahydronaphthalen-1-amine;ethyl acetate |
|---|---|
| PubChem CID | 142148722 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-ethenyl-3-methoxy-5,6,7,8-tetrahydronaphthalen-1-amine;ethyl acetate |
| SMILES | C=Cc1c(OC)cc2c(c1N)CCCC2.CCOC(C)=O |
| InChI | InChI=1S/C13H17NO.C4H8O2/c1-3-10-12(15-2)8-9-6-4-5-7-11(9)13(10)14;1-3-6-4(2)5/h3,8H,1,4-7,14H2,2H3;3H2,1-2H3 |
| InChIKey | NLYONHRYHNBIBJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|