C21H22F3NO2 — CID 168905325
ethane;2-ethenyl-4-methyl-3-prop-1-ynoxy-5-[4-(trifluoromethoxy)phenyl]aniline (PubChem CID 168905325) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is ethane;2-ethenyl-4-methyl-3-prop-1-ynoxy-5-[4-(trifluoromethoxy)phenyl]aniline.
| Compound Name | ethane;2-ethenyl-4-methyl-3-prop-1-ynoxy-5-[4-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 168905325 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | ethane;2-ethenyl-4-methyl-3-prop-1-ynoxy-5-[4-(trifluoromethoxy)phenyl]aniline |
| SMILES | C=Cc1c(N)cc(-c2ccc(OC(F)(F)F)cc2)c(C)c1OC#CC.CC |
| InChI | InChI=1S/C19H16F3NO2.C2H6/c1-4-10-24-18-12(3)16(11-17(23)15(18)5-2)13-6-8-14(9-7-13)25-19(20,21)22;1-2/h5-9,11H,2,23H2,1,3H3;1-2H3 |
| InChIKey | GITDFVRSZCUWOV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|