C25H27NO5Se — CID 11271989
methyl (1R,4aS,9aR)-5-acetyloxy-6-methoxy-7,8-dimethyl-1-phenylselanyl-1,2,4a,9a-tetrahydrocarbazole-9-carboxylate (PubChem CID 11271989) has the molecular formula C25H27NO5Se and a molecular weight of 500.45 g/mol. Its IUPAC name is methyl (1R,4aS,9aR)-5-acetyloxy-6-methoxy-7,8-dimethyl-1-phenylselanyl-1,2,4a,9a-tetrahydrocarbazole-9-carboxylate.
| Compound Name | methyl (1R,4aS,9aR)-5-acetyloxy-6-methoxy-7,8-dimethyl-1-phenylselanyl-1,2,4a,9a-tetrahydrocarbazole-9-carboxylate |
|---|---|
| PubChem CID | 11271989 |
| Molecular Formula | C25H27NO5Se |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | methyl (1R,4aS,9aR)-5-acetyloxy-6-methoxy-7,8-dimethyl-1-phenylselanyl-1,2,4a,9a-tetrahydrocarbazole-9-carboxylate |
| SMILES | COC(=O)N1c2c(C)c(C)c(OC)c(OC(C)=O)c2[C@@H]2C=CC[C@@H]([Se]c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C25H27NO5Se/c1-14-15(2)23(29-4)24(31-16(3)27)20-18-12-9-13-19(32-17-10-7-6-8-11-17)22(18)26(21(14)20)25(28)30-5/h6-12,18-19,22H,13H2,1-5H3/t18-,19+,22+/m0/s1 |
| InChIKey | QHQLSTXMZDZWJP-NNMXDRDESA-N |
| XLogP | 4.05 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|