C19H27NO4 — CID 56835696
tert-butyl (E,2R)-2-(2-methylpropyl)-2-nitro-5-phenylpent-4-enoate (PubChem CID 56835696) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl (E,2R)-2-(2-methylpropyl)-2-nitro-5-phenylpent-4-enoate.
| Compound Name | tert-butyl (E,2R)-2-(2-methylpropyl)-2-nitro-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 56835696 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | tert-butyl (E,2R)-2-(2-methylpropyl)-2-nitro-5-phenylpent-4-enoate |
| SMILES | CC(C)C[C@@](C/C=C/c1ccccc1)(C(=O)OC(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C19H27NO4/c1-15(2)14-19(20(22)23,17(21)24-18(3,4)5)13-9-12-16-10-7-6-8-11-16/h6-12,15H,13-14H2,1-5H3/b12-9+/t19-/m0/s1 |
| InChIKey | ZXDZVBXHGPWWCS-DLENHJPASA-N |
| XLogP | 4.49 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|