C49H64O3 — CID 56842404
2,6-bis[3-(3-tert-butyl-2-hydroxy-5-methylphenyl)-3-tricyclo[5.2.1.02,6]decanyl]-4-methylphenol (PubChem CID 56842404) has the molecular formula C49H64O3 and a molecular weight of 701.05 g/mol. Its IUPAC name is 2,6-bis[3-(3-tert-butyl-2-hydroxy-5-methylphenyl)-3-tricyclo[5.2.1.02,6]decanyl]-4-methylphenol.
| Compound Name | 2,6-bis[3-(3-tert-butyl-2-hydroxy-5-methylphenyl)-3-tricyclo[5.2.1.02,6]decanyl]-4-methylphenol |
|---|---|
| PubChem CID | 56842404 |
| Molecular Formula | C49H64O3 |
| Molecular Weight | 701.05 g/mol |
| Exact Mass | 700.49 |
| IUPAC Name | 2,6-bis[3-(3-tert-butyl-2-hydroxy-5-methylphenyl)-3-tricyclo[5.2.1.02,6]decanyl]-4-methylphenol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C2(c3cc(C)cc(C4(c5cc(C)cc(C(C)(C)C)c5O)CCC5C6CCC(C6)C54)c3O)CCC3C4CCC(C4)C32)c1 |
| InChI | InChI=1S/C49H64O3/c1-26-18-35(46(4,5)6)43(50)37(20-26)48(16-14-33-29-10-12-31(24-29)41(33)48)39-22-28(3)23-40(45(39)52)49(17-15-34-30-11-13-32(25-30)42(34)49)38-21-27(2)19-36(44(38)51)47(7,8)9/h18-23,29-34,41-42,50-52H,10-17,24-25H2,1-9H3 |
| InChIKey | HCAQPAMZCORZDE-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.05 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |