C33H40ClN3O — CID 56850164
(3S,8S,9S,10R,13S,14S,17S)-17-[2-(4-chlorophenyl)-3-pyridin-2-yl-3,4-dihydropyrazol-5-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 56850164) has the molecular formula C33H40ClN3O and a molecular weight of 530.16 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-[2-(4-chlorophenyl)-3-pyridin-2-yl-3,4-dihydropyrazol-5-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-[2-(4-chlorophenyl)-3-pyridin-2-yl-3,4-dihydropyrazol-5-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 56850164 |
| Molecular Formula | C33H40ClN3O |
| Molecular Weight | 530.16 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[2-(4-chlorophenyl)-3-pyridin-2-yl-3,4-dihydropyrazol-5-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2C1=NN(c2ccc(Cl)cc2)C(c2ccccn2)C1 |
| InChI | InChI=1S/C33H40ClN3O/c1-32-16-14-24(38)19-21(32)6-11-25-26-12-13-28(33(26,2)17-15-27(25)32)30-20-31(29-5-3-4-18-35-29)37(36-30)23-9-7-22(34)8-10-23/h3-10,18,24-28,31,38H,11-17,19-20H2,1-2H3/t24-,25-,26-,27-,28+,31?,32-,33-/m0/s1 |
| InChIKey | BVOKELWTJMTFSX-OQUCTSKTSA-N |
| XLogP | 7.98 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.16 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|