C16H24N4O2S — CID 56858767
(7S,9aR)-7-(4-aminobutyl)-2-(thiophen-3-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56858767) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is (7S,9aR)-7-(4-aminobutyl)-2-(thiophen-3-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-(4-aminobutyl)-2-(thiophen-3-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56858767 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (7S,9aR)-7-(4-aminobutyl)-2-(thiophen-3-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | NCCCC[C@@H]1NC(=O)[C@H]2CN(Cc3ccsc3)CCN2C1=O |
| InChI | InChI=1S/C16H24N4O2S/c17-5-2-1-3-13-16(22)20-7-6-19(9-12-4-8-23-11-12)10-14(20)15(21)18-13/h4,8,11,13-14H,1-3,5-7,9-10,17H2,(H,18,21)/t13-,14+/m0/s1 |
| InChIKey | LGEQEMFTOKMTLW-UONOGXRCSA-N |
| XLogP | 0.39 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|