C13H21N3O2 — CID 56859582
(7S,9aR)-2-(cyclopropylmethyl)-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56859582) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is (7S,9aR)-2-(cyclopropylmethyl)-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-(cyclopropylmethyl)-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56859582 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | (7S,9aR)-2-(cyclopropylmethyl)-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | C[C@H]1C(=O)N2CCN(CC3CC3)C[C@@H]2C(=O)N1C |
| InChI | InChI=1S/C13H21N3O2/c1-9-12(17)16-6-5-15(7-10-3-4-10)8-11(16)13(18)14(9)2/h9-11H,3-8H2,1-2H3/t9-,11+/m0/s1 |
| InChIKey | QNSZLXDLWWKLEP-GXSJLCMTSA-N |
| XLogP | -0.23 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |