C19H21NO7S — CID 56865018
3-(3,5-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzoic acid (PubChem CID 56865018) has the molecular formula C19H21NO7S and a molecular weight of 407.44 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzoic acid.
| Compound Name | 3-(3,5-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 56865018 |
| Molecular Formula | C19H21NO7S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzoic acid |
| SMILES | COc1cc(OC)cc(-c2cc(C(=O)O)cc(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C19H21NO7S/c1-25-16-8-14(9-17(12-16)26-2)13-7-15(19(21)22)11-18(10-13)28(23,24)20-3-5-27-6-4-20/h7-12H,3-6H2,1-2H3,(H,21,22) |
| InChIKey | BLMOZNRSPGHWAK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |