C15H15NO5S2 — CID 56868736
3-(furan-3-yl)-5-thiomorpholin-4-ylsulfonylbenzoic acid (PubChem CID 56868736) has the molecular formula C15H15NO5S2 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-(furan-3-yl)-5-thiomorpholin-4-ylsulfonylbenzoic acid.
| Compound Name | 3-(furan-3-yl)-5-thiomorpholin-4-ylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 56868736 |
| Molecular Formula | C15H15NO5S2 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 3-(furan-3-yl)-5-thiomorpholin-4-ylsulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(-c2ccoc2)cc(S(=O)(=O)N2CCSCC2)c1 |
| InChI | InChI=1S/C15H15NO5S2/c17-15(18)13-7-12(11-1-4-21-10-11)8-14(9-13)23(19,20)16-2-5-22-6-3-16/h1,4,7-10H,2-3,5-6H2,(H,17,18) |
| InChIKey | YPNQUQFYKQKQDS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |