C20H21N3O4S — CID 56880235
3-(1H-indol-6-yl)-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid (PubChem CID 56880235) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-(1H-indol-6-yl)-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid.
| Compound Name | 3-(1H-indol-6-yl)-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 56880235 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-(1H-indol-6-yl)-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid |
| SMILES | CN1CCN(S(=O)(=O)c2cc(C(=O)O)cc(-c3ccc4cc[nH]c4c3)c2)CC1 |
| InChI | InChI=1S/C20H21N3O4S/c1-22-6-8-23(9-7-22)28(26,27)18-11-16(10-17(12-18)20(24)25)15-3-2-14-4-5-21-19(14)13-15/h2-5,10-13,21H,6-9H2,1H3,(H,24,25) |
| InChIKey | IHWXGPXGEZUBJK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |