C13H14N4O4S2 — CID 56880589
3-thiomorpholin-4-ylsulfonyl-5-(triazol-1-yl)benzoic acid (PubChem CID 56880589) has the molecular formula C13H14N4O4S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-thiomorpholin-4-ylsulfonyl-5-(triazol-1-yl)benzoic acid.
| Compound Name | 3-thiomorpholin-4-ylsulfonyl-5-(triazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 56880589 |
| Molecular Formula | C13H14N4O4S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 3-thiomorpholin-4-ylsulfonyl-5-(triazol-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc(-n2ccnn2)cc(S(=O)(=O)N2CCSCC2)c1 |
| InChI | InChI=1S/C13H14N4O4S2/c18-13(19)10-7-11(17-2-1-14-15-17)9-12(8-10)23(20,21)16-3-5-22-6-4-16/h1-2,7-9H,3-6H2,(H,18,19) |
| InChIKey | HZHNSKDYLOEGIV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |