C18H18FNO5S2 — CID 56861096
3-(4-fluoro-2-methoxyphenyl)-5-thiomorpholin-4-ylsulfonylbenzoic acid (PubChem CID 56861096) has the molecular formula C18H18FNO5S2 and a molecular weight of 411.48 g/mol. Its IUPAC name is 3-(4-fluoro-2-methoxyphenyl)-5-thiomorpholin-4-ylsulfonylbenzoic acid.
| Compound Name | 3-(4-fluoro-2-methoxyphenyl)-5-thiomorpholin-4-ylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 56861096 |
| Molecular Formula | C18H18FNO5S2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 3-(4-fluoro-2-methoxyphenyl)-5-thiomorpholin-4-ylsulfonylbenzoic acid |
| SMILES | COc1cc(F)ccc1-c1cc(C(=O)O)cc(S(=O)(=O)N2CCSCC2)c1 |
| InChI | InChI=1S/C18H18FNO5S2/c1-25-17-11-14(19)2-3-16(17)12-8-13(18(21)22)10-15(9-12)27(23,24)20-4-6-26-7-5-20/h2-3,8-11H,4-7H2,1H3,(H,21,22) |
| InChIKey | UVBCFPSRTJLEOY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |