C15H23N3O3 — CID 56869620
1-(5-ethylpyrimidin-2-yl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid (PubChem CID 56869620) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-(5-ethylpyrimidin-2-yl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(5-ethylpyrimidin-2-yl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 56869620 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-(5-ethylpyrimidin-2-yl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
| SMILES | CCc1cnc(N2CCCC(CCOC)(C(=O)O)C2)nc1 |
| InChI | InChI=1S/C15H23N3O3/c1-3-12-9-16-14(17-10-12)18-7-4-5-15(11-18,13(19)20)6-8-21-2/h9-10H,3-8,11H2,1-2H3,(H,19,20) |
| InChIKey | AOEFAJUQBYOEGZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |