C10H10F3N3O3 — CID 56876065
5-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one (PubChem CID 56876065) has the molecular formula C10H10F3N3O3 and a molecular weight of 277.20 g/mol. Its IUPAC name is 5-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 5-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 56876065 |
| Molecular Formula | C10H10F3N3O3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 5-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one |
| SMILES | O=C(c1cnc[nH]c1=O)N1CCOC(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H10F3N3O3/c11-10(12,13)7-4-16(1-2-19-7)9(18)6-3-14-5-15-8(6)17/h3,5,7H,1-2,4H2,(H,14,15,17) |
| InChIKey | GAWWQRWMPZXTAK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |