C13H14F3N3O3 — CID 95539294
2-cyclopropyl-5-[(2R)-2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one (PubChem CID 95539294) has the molecular formula C13H14F3N3O3 and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-cyclopropyl-5-[(2R)-2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-5-[(2R)-2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 95539294 |
| Molecular Formula | C13H14F3N3O3 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-cyclopropyl-5-[(2R)-2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one |
| SMILES | O=C(c1cnc(C2CC2)[nH]c1=O)N1CCO[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C13H14F3N3O3/c14-13(15,16)9-6-19(3-4-22-9)12(21)8-5-17-10(7-1-2-7)18-11(8)20/h5,7,9H,1-4,6H2,(H,17,18,20)/t9-/m1/s1 |
| InChIKey | WFSJGLOZIVBMEX-SECBINFHSA-N |
| XLogP | 1.05 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |