C19H33N5 — CID 56879801
4-cyclobutyl-N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]-6-methylpyrimidin-2-amine (PubChem CID 56879801) has the molecular formula C19H33N5 and a molecular weight of 331.51 g/mol. Its IUPAC name is 4-cyclobutyl-N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]-6-methylpyrimidin-2-amine.
| Compound Name | 4-cyclobutyl-N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 56879801 |
| Molecular Formula | C19H33N5 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 4-cyclobutyl-N-[2-(4-ethylpiperazin-1-yl)-2-methylpropyl]-6-methylpyrimidin-2-amine |
| SMILES | CCN1CCN(C(C)(C)CNc2nc(C)cc(C3CCC3)n2)CC1 |
| InChI | InChI=1S/C19H33N5/c1-5-23-9-11-24(12-10-23)19(3,4)14-20-18-21-15(2)13-17(22-18)16-7-6-8-16/h13,16H,5-12,14H2,1-4H3,(H,20,21,22) |
| InChIKey | JYMJKAFLAMSSDB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |