C20H28N4O — CID 56880401
3-[6-[ethyl(methyl)amino]pyrimidin-4-yl]-5-(2-piperidin-2-ylethyl)phenol (PubChem CID 56880401) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 3-[6-[ethyl(methyl)amino]pyrimidin-4-yl]-5-(2-piperidin-2-ylethyl)phenol.
| Compound Name | 3-[6-[ethyl(methyl)amino]pyrimidin-4-yl]-5-(2-piperidin-2-ylethyl)phenol |
|---|---|
| PubChem CID | 56880401 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 3-[6-[ethyl(methyl)amino]pyrimidin-4-yl]-5-(2-piperidin-2-ylethyl)phenol |
| SMILES | CCN(C)c1cc(-c2cc(O)cc(CCC3CCCCN3)c2)ncn1 |
| InChI | InChI=1S/C20H28N4O/c1-3-24(2)20-13-19(22-14-23-20)16-10-15(11-18(25)12-16)7-8-17-6-4-5-9-21-17/h10-14,17,21,25H,3-9H2,1-2H3 |
| InChIKey | DUXMEPSMXOLZDT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |