C19H24N2O — CID 95554178
3-(2-methyl-4-pyridinyl)-5-[2-[(2R)-piperidin-2-yl]ethyl]phenol (PubChem CID 95554178) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(2-methyl-4-pyridinyl)-5-[2-[(2R)-piperidin-2-yl]ethyl]phenol.
| Compound Name | 3-(2-methyl-4-pyridinyl)-5-[2-[(2R)-piperidin-2-yl]ethyl]phenol |
|---|---|
| PubChem CID | 95554178 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 3-(2-methyl-4-pyridinyl)-5-[2-[(2R)-piperidin-2-yl]ethyl]phenol |
| SMILES | Cc1cc(-c2cc(O)cc(CC[C@H]3CCCCN3)c2)ccn1 |
| InChI | InChI=1S/C19H24N2O/c1-14-10-16(7-9-20-14)17-11-15(12-19(22)13-17)5-6-18-4-2-3-8-21-18/h7,9-13,18,21-22H,2-6,8H2,1H3/t18-/m1/s1 |
| InChIKey | RGFZPNJHOIQTKC-GOSISDBHSA-N |
| XLogP | 3.84 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |