C19H25NO3S2 — CID 56868049
3-(5-ethylsulfonylthiophen-2-yl)-5-(2-piperidin-2-ylethyl)phenol (PubChem CID 56868049) has the molecular formula C19H25NO3S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is 3-(5-ethylsulfonylthiophen-2-yl)-5-(2-piperidin-2-ylethyl)phenol.
| Compound Name | 3-(5-ethylsulfonylthiophen-2-yl)-5-(2-piperidin-2-ylethyl)phenol |
|---|---|
| PubChem CID | 56868049 |
| Molecular Formula | C19H25NO3S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-(5-ethylsulfonylthiophen-2-yl)-5-(2-piperidin-2-ylethyl)phenol |
| SMILES | CCS(=O)(=O)c1ccc(-c2cc(O)cc(CCC3CCCCN3)c2)s1 |
| InChI | InChI=1S/C19H25NO3S2/c1-2-25(22,23)19-9-8-18(24-19)15-11-14(12-17(21)13-15)6-7-16-5-3-4-10-20-16/h8-9,11-13,16,20-21H,2-7,10H2,1H3 |
| InChIKey | RVYQGFOFTYFGNH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |