C17H21N3O — CID 56750474
3-(2-piperidin-2-ylethyl)-5-pyrimidin-2-ylphenol (PubChem CID 56750474) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-(2-piperidin-2-ylethyl)-5-pyrimidin-2-ylphenol.
| Compound Name | 3-(2-piperidin-2-ylethyl)-5-pyrimidin-2-ylphenol |
|---|---|
| PubChem CID | 56750474 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-(2-piperidin-2-ylethyl)-5-pyrimidin-2-ylphenol |
| SMILES | Oc1cc(CCC2CCCCN2)cc(-c2ncccn2)c1 |
| InChI | InChI=1S/C17H21N3O/c21-16-11-13(5-6-15-4-1-2-7-18-15)10-14(12-16)17-19-8-3-9-20-17/h3,8-12,15,18,21H,1-2,4-7H2 |
| InChIKey | IQCPDMRMGGHUER-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |