C21H31N3O2 — CID 56881973
[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 56881973) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is [(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 56881973 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | [(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)N2CC[C@@](O)(c3ccccc3)[C@H]3CCCC[C@@H]32)CC1 |
| InChI | InChI=1S/C21H31N3O2/c1-22-13-15-23(16-14-22)20(25)24-12-11-21(26,17-7-3-2-4-8-17)18-9-5-6-10-19(18)24/h2-4,7-8,18-19,26H,5-6,9-16H2,1H3/t18-,19-,21+/m0/s1 |
| InChIKey | GOBNLSIGZWUFGV-IRFCIJBXSA-N |
| XLogP | 2.51 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |