C19H31N5O — CID 56882461
4-[2-methyl-6-[1-(pyrrolidin-3-ylmethyl)piperidin-4-yl]pyrimidin-4-yl]morpholine (PubChem CID 56882461) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-[2-methyl-6-[1-(pyrrolidin-3-ylmethyl)piperidin-4-yl]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-methyl-6-[1-(pyrrolidin-3-ylmethyl)piperidin-4-yl]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 56882461 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 4-[2-methyl-6-[1-(pyrrolidin-3-ylmethyl)piperidin-4-yl]pyrimidin-4-yl]morpholine |
| SMILES | Cc1nc(C2CCN(CC3CCNC3)CC2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H31N5O/c1-15-21-18(12-19(22-15)24-8-10-25-11-9-24)17-3-6-23(7-4-17)14-16-2-5-20-13-16/h12,16-17,20H,2-11,13-14H2,1H3 |
| InChIKey | XIVJJKUUPHSUJM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |