C16H22F3N5O — CID 56882488
(4aS,8aR)-1-[2-(methylamino)ethyl]-6-[4-(trifluoromethyl)pyrimidin-2-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56882488) has the molecular formula C16H22F3N5O and a molecular weight of 357.38 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[4-(trifluoromethyl)pyrimidin-2-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[4-(trifluoromethyl)pyrimidin-2-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56882488 |
| Molecular Formula | C16H22F3N5O |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[4-(trifluoromethyl)pyrimidin-2-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(c3nccc(C(F)(F)F)n3)CC[C@H]21 |
| InChI | InChI=1S/C16H22F3N5O/c1-20-7-9-24-12-5-8-23(10-11(12)2-3-14(24)25)15-21-6-4-13(22-15)16(17,18)19/h4,6,11-12,20H,2-3,5,7-10H2,1H3/t11-,12+/m0/s1 |
| InChIKey | UJVHSDWEYYUMSA-NWDGAFQWSA-N |
| XLogP | 1.53 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |