C12H17N3O3S — CID 56884915
N-[(1S,2R)-2-aminocyclobutyl]-2-methyl-5-sulfamoylbenzamide (PubChem CID 56884915) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is N-[(1S,2R)-2-aminocyclobutyl]-2-methyl-5-sulfamoylbenzamide.
| Compound Name | N-[(1S,2R)-2-aminocyclobutyl]-2-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 56884915 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-[(1S,2R)-2-aminocyclobutyl]-2-methyl-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)N[C@H]1CC[C@H]1N |
| InChI | InChI=1S/C12H17N3O3S/c1-7-2-3-8(19(14,17)18)6-9(7)12(16)15-11-5-4-10(11)13/h2-3,6,10-11H,4-5,13H2,1H3,(H,15,16)(H2,14,17,18)/t10-,11+/m1/s1 |
| InChIKey | FRXDJBSQDGZLHI-MNOVXSKESA-N |
| XLogP | -0.14 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |