C17H21N3O3 — CID 56885073
N-[(4-hydroxyazepan-4-yl)methyl]-4-oxo-1H-quinoline-2-carboxamide (PubChem CID 56885073) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[(4-hydroxyazepan-4-yl)methyl]-4-oxo-1H-quinoline-2-carboxamide.
| Compound Name | N-[(4-hydroxyazepan-4-yl)methyl]-4-oxo-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 56885073 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[(4-hydroxyazepan-4-yl)methyl]-4-oxo-1H-quinoline-2-carboxamide |
| SMILES | O=C(NCC1(O)CCCNCC1)c1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C17H21N3O3/c21-15-10-14(20-13-5-2-1-4-12(13)15)16(22)19-11-17(23)6-3-8-18-9-7-17/h1-2,4-5,10,18,23H,3,6-9,11H2,(H,19,22)(H,20,21) |
| InChIKey | DGWJIHOYDOXZMQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |